|
CAS#: 84434-87-7 Product: Lithium 1H-Indole-3-Acetate No suppilers available for the product. |
| Name | Lithium 1H-Indole-3-Acetate |
|---|---|
| Synonyms | Lithium 2-(1H-Indol-3-Yl)Ethanoate; Lithium 1H-Indole-3-Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8LiNO2 |
| Molecular Weight | 181.12 |
| CAS Registry Number | 84434-87-7 |
| EINECS | 282-880-8 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)CC([O-])=O.[Li+] |
| InChI | 1S/C10H9NO2.Li/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9;/h1-4,6,11H,5H2,(H,12,13);/q;+1/p-1 |
| InChIKey | FRVPNUXWQWLOTB-UHFFFAOYSA-M |
| Boiling point | 415°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 204.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lithium 1H-Indole-3-Acetate |