Online Database of Chemicals from Around the World
|
CAS#: 84473-58-5 Product: 1,2,4,5-Tetrabromo-3,6-Bis[(2,4,6-Tribromophenoxy)Methyl]Benzene No suppilers available for the product. |
| Name | 1,2,4,5-Tetrabromo-3,6-Bis[(2,4,6-Tribromophenoxy)Methyl]Benzene |
|---|---|
| Synonyms | 1,2,4,5-Tetrabromo-3,6-Bis((2,4,6-Tribromophenoxy)Methyl)Benzene |
| Molecular Structure | ![CAS#: 84473-58-5, 1,2,4,5-Tetrabromo-3,6-Bis[(2,4,6-Tribromophenoxy)Methyl]Benzene](/moreStructures/84473-58-5.gif) |
| Molecular Formula | C20H8Br10O2 |
| Molecular Weight | 1079.32 |
| CAS Registry Number | 84473-58-5 |
| EINECS | 282-912-0 |
| SMILES | C1=C(Br)C=C(Br)C(=C1Br)OCC2=C(Br)C(=C(C(=C2Br)Br)COC3=C(Br)C=C(Br)C=C3Br)Br |
| InChI | 1S/C20H8Br10O2/c21-7-1-11(23)19(12(24)2-7)31-5-9-15(27)17(29)10(18(30)16(9)28)6-32-20-13(25)3-8(22)4-14(20)26/h1-4H,5-6H2 |
| InChIKey | NVJQEKQKJFEBBS-UHFFFAOYSA-N |
| Density | 2.566g/cm3 (Cal.) |
|---|---|
| Boiling point | 770.761°C at 760 mmHg (Cal.) |
| Flash point | 329.536°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5-Tetrabromo-3,6-Bis[(2,4,6-Tribromophenoxy)Methyl]Benzene |