|
CAS#: 84473-65-4 Product: phenethylammonium citrate No suppilers available for the product. |
| Name | phenethylammonium citrate |
|---|---|
| Synonyms | phenethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H17NO7 |
| Molecular Weight | 311.29 |
| CAS Registry Number | 84473-65-4 |
| EINECS | 282-919-9 |
| SMILES | [NH3+]CCc1ccccc1.[O-]C(=O)C(O)(CC([O-])=O)CC([O-])=O |
| InChI | 1S/C8H11N.C6H8O7/c9-7-6-8-4-2-1-3-5-8;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-5H,6-7,9H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/p-2 |
| InChIKey | CTBJILANYAWODF-UHFFFAOYSA-L |
| Boiling point | 469.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for phenethylammonium citrate |