|
CAS#: 84495-20-5 Product: 2'-Epi-Distichonic Acid A No suppilers available for the product. |
| Name | 2'-Epi-Distichonic Acid A |
|---|---|
| Synonyms | (2S,3R)-4-(Carboxymethylamino)-3-Hydroxy-2-[(2,3,4-Trihydroxy-4-Oxo-Butyl)Amino]Butanoic Acid; (2S,3R)-4-(Carboxymethylamino)-3-Hydroxy-2-[(2,3,4-Trihydroxy-4-Keto-Butyl)Amino]Butyric Acid; 2'-Distichonic Acid A |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O9 |
| Molecular Weight | 310.26 |
| CAS Registry Number | 84495-20-5 |
| SMILES | [C@H](NCC(O)C(O)C(=O)O)([C@H](O)CNCC(=O)O)C(=O)O |
| InChI | 1S/C10H18N2O9/c13-4(1-11-3-6(15)16)7(9(18)19)12-2-5(14)8(17)10(20)21/h4-5,7-8,11-14,17H,1-3H2,(H,15,16)(H,18,19)(H,20,21)/t4-,5?,7+,8?/m1/s1 |
| InChIKey | MTSCMKDFRXDNNA-RCAXORGESA-N |
| Density | 1.64g/cm3 (Cal.) |
|---|---|
| Boiling point | 788.638°C at 760 mmHg (Cal.) |
| Flash point | 430.753°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2'-Epi-Distichonic Acid A |