|
CAS#: 84540-41-0 Product: Vinyl 6-Chlorotoluene-3-Sulphonate No suppilers available for the product. |
| Name | Vinyl 6-Chlorotoluene-3-Sulphonate |
|---|---|
| Synonyms | Vinyl 4-Chloro-3-Methyl-Benzenesulfonate; 4-Chloro-3-Methylbenzenesulfonic Acid Vinyl Ester; 4-Chloro-3-Methyl-Benzenesulfonic Acid Vinyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClO3S |
| Molecular Weight | 232.68 |
| CAS Registry Number | 84540-41-0 |
| EINECS | 283-134-4 |
| SMILES | C1=C(C(=CC=C1[S](OC=C)(=O)=O)Cl)C |
| InChI | 1S/C9H9ClO3S/c1-3-13-14(11,12)8-4-5-9(10)7(2)6-8/h3-6H,1H2,2H3 |
| InChIKey | OKHXKDPGLQZKKE-UHFFFAOYSA-N |
| Density | 1.312g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.238°C at 760 mmHg (Cal.) |
| Flash point | 165.013°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyl 6-Chlorotoluene-3-Sulphonate |