|
CAS#: 84559-96-6 Product: 1-[5-Methyl-2-(1-Methylethyl)-2-Cyclohexen-1-Yl]Propan-1-One No suppilers available for the product. |
| Name | 1-[5-Methyl-2-(1-Methylethyl)-2-Cyclohexen-1-Yl]Propan-1-One |
|---|---|
| Synonyms | 1-(2-Isopropyl-5-Methyl-1-Cyclohex-2-Enyl)Propan-1-One; 1-(5-Methyl-2-(1-Methylethyl)-2-Cyclohexen-1-Yl)Propan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 84559-96-6 |
| EINECS | 283-183-1 |
| SMILES | C(C(=O)C1C(=CCC(C1)C)C(C)C)C |
| InChI | 1S/C13H22O/c1-5-13(14)12-8-10(4)6-7-11(12)9(2)3/h7,9-10,12H,5-6,8H2,1-4H3 |
| InChIKey | WQTULNIVXGGNNJ-UHFFFAOYSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 263.202°C at 760 mmHg (Cal.) |
| Flash point | 103.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[5-Methyl-2-(1-Methylethyl)-2-Cyclohexen-1-Yl]Propan-1-One |