|
CAS#: 84560-09-8 Product: 2-(Diethylamino)ethyl 3-(2-furyl)-2-(2-thienylmethyl)propanoate hydrochloride (1:1) No suppilers available for the product. |
| Name | 2-(Diethylamino)ethyl 3-(2-furyl)-2-(2-thienylmethyl)propanoate hydrochloride (1:1) |
|---|---|
| Synonyms | 2-(diethy |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26ClNO3S |
| Molecular Weight | 371.92 |
| CAS Registry Number | 84560-09-8 |
| EINECS | 283-197-8 |
| SMILES | Cl.O=C(OCCN(CC)CC)C(Cc1cccs1)Cc2ccco2 |
| InChI | 1S/C18H25NO3S.ClH/c1-3-19(4-2)9-11-22-18(20)15(13-16-7-5-10-21-16)14-17-8-6-12-23-17;/h5-8,10,12,15H,3-4,9,11,13-14H2,1-2H3;1H |
| InChIKey | JMXVIVVNSLWTJU-UHFFFAOYSA-N |
| Boiling point | 460.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 232.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)ethyl 3-(2-furyl)-2-(2-thienylmethyl)propanoate hydrochloride (1:1) |