|
CAS#: 84605-06-1 Product: N'-Nitroso-N-Nitroso-N-Methyl-3-Aminomethylindole No suppilers available for the product. |
| Name | N'-Nitroso-N-Nitroso-N-Methyl-3-Aminomethylindole |
|---|---|
| Synonyms | N-Methyl-N-[(1-Nitroso-3-Indolyl)Methyl]Nitrous Amide; 1H-Indole-3-Methanamine, N-Methyl-N,1-Dinitroso-; N'-Nitroso-N-Nitroso-N-Methyl-3-Aminomethylindole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21 |
| CAS Registry Number | 84605-06-1 |
| SMILES | C1=C(C2=C([N]1N=O)C=CC=C2)CN(N=O)C |
| InChI | 1S/C10H10N4O2/c1-13(11-15)6-8-7-14(12-16)10-5-3-2-4-9(8)10/h2-5,7H,6H2,1H3 |
| InChIKey | RZJVFBBBIQVYPF-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.283°C at 760 mmHg (Cal.) |
| Flash point | 230.961°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-Nitroso-N-Nitroso-N-Methyl-3-Aminomethylindole |