|
CAS#: 84613-57-0 Product: 1-(4-Chloro-2-nitrophenyl)-2-(4-methoxyphenyl)diazene No suppilers available for the product. |
| Name | 1-(4-Chloro-2-nitrophenyl)-2-(4-methoxyphenyl)diazene |
|---|---|
| Synonyms | 4-chloro-4'-methoxy-2-nitroazobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 |
| CAS Registry Number | 84613-57-0 |
| EINECS | 283-394-9 |
| SMILES | Clc2cc(c(N=Nc1ccc(OC)cc1)cc2)[N+]([O-])=O |
| InChI | 1S/C13H10ClN3O3/c1-20-11-5-3-10(4-6-11)15-16-12-7-2-9(14)8-13(12)17(18)19/h2-8H,1H3 |
| InChIKey | YVBBYHMLWXNHCI-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.19°C at 760 mmHg (Cal.) |
| Flash point | 228.486°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Chloro-2-nitrophenyl)-2-(4-methoxyphenyl)diazene |