|
CAS#: 84642-55-7 Product: 1-Methyl-2-Oxopropyl Phenylacetate No suppilers available for the product. |
| Name | 1-Methyl-2-Oxopropyl Phenylacetate |
|---|---|
| Synonyms | (1-Methyl-2-Oxo-Propyl) 2-Phenylacetate; 2-Phenylacetic Acid (1-Methyl-2-Oxopropyl) Ester; 2-Phenylacetic Acid (2-Keto-1-Methyl-Propyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 84642-55-7 |
| EINECS | 283-431-9 |
| SMILES | C1=C(CC(OC(C)C(=O)C)=O)C=CC=C1 |
| InChI | 1S/C12H14O3/c1-9(13)10(2)15-12(14)8-11-6-4-3-5-7-11/h3-7,10H,8H2,1-2H3 |
| InChIKey | GIIKAFRAYAIAAR-UHFFFAOYSA-N |
| Density | 1.09g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.894°C at 760 mmHg (Cal.) |
| Flash point | 132.265°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-Oxopropyl Phenylacetate |