|
CAS#: 84682-40-6 Product: (11beta,16alpha)-16-Methyl-3,20-dioxopregna-1,4-diene-11,21-diyl diacetate No suppilers available for the product. |
| Name | (11beta,16alpha)-16-Methyl-3,20-dioxopregna-1,4-diene-11,21-diyl diacetate |
|---|---|
| Synonyms | 11β,21-di |
| Molecular Structure | ![]() |
| Molecular Formula | C26H34O6 |
| Molecular Weight | 442.54 |
| CAS Registry Number | 84682-40-6 |
| EINECS | 283-603-3 |
| SMILES | CC(=O)OCC(=O)[C@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@H](C[C@]12C)OC(C)=O |
| InChI | 1S/C26H34O6/c1-14-10-20-19-7-6-17-11-18(29)8-9-25(17,4)24(19)22(32-16(3)28)12-26(20,5)23(14)21(30)13-31-15(2)27/h8-9,11,14,19-20,22-24H,6-7,10,12-13H2,1-5H3/t14-,19+,20+,22+,23-,24-,25+,26+/m1/s1 |
| InChIKey | DZJOCIZYNQZSAL-VZKQCUHKSA-N |
| Density | 1.196g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.778°C at 760 mmHg (Cal.) |
| Flash point | 236.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (11beta,16alpha)-16-Methyl-3,20-dioxopregna-1,4-diene-11,21-diyl diacetate |