|
CAS#: 84693-92-5 Product: 16-Fluoroestradiol No suppilers available for the product. |
| Name | 16-Fluoroestradiol |
|---|---|
| Synonyms | 16-Fluoroestradiol; 16Alpha-(18)-Fluoro-17Beta-Estradiol; 16Alpha-Fluoroestradiol |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23FO2 |
| Molecular Weight | 290.38 |
| CAS Registry Number | 84693-92-5 |
| SMILES | [C@H]34[C@H]2[C@@H](C1=CC=C(O)C=C1CC2)CC[C@@]3([C@@H](O)[C@@H](F)C4)C |
| InChI | 1S/C18H23FO2/c1-18-7-6-13-12-5-3-11(20)8-10(12)2-4-14(13)15(18)9-16(19)17(18)21/h3,5,8,13-17,20-21H,2,4,6-7,9H2,1H3/t13-,14-,15+,16+,17+,18+/m1/s1 |
| InChIKey | KDLLNMRYZGUVMA-ZMSHIADSSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 453.58°C at 760 mmHg (Cal.) |
| Flash point | 228.117°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-Fluoroestradiol |