Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 2-[(4-Methylphenyl)Methylene]Heptan-1-Al |
|---|---|
| Synonyms | (2Z)-2-[(4-Methylphenyl)Methylene]Heptanal; (Z)-2-Amyl-3-(4-Methylphenyl)Acrolein; 2-((4-Methylphenyl)Methylene)Heptan-1-Al |
| Molecular Structure | ![CAS#: 84697-09-6, 2-[(4-Methylphenyl)Methylene]Heptan-1-Al](/moreStructures/84697-09-6.gif) |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 |
| CAS Registry Number | 84697-09-6 |
| EINECS | 283-718-9 |
| SMILES | C1=C(/C=C(C=O)/CCCCC)C=CC(=C1)C |
| InChI | 1S/C15H20O/c1-3-4-5-6-15(12-16)11-14-9-7-13(2)8-10-14/h7-12H,3-6H2,1-2H3/b15-11- |
| InChIKey | VHBOIZSCWFNPBM-PTNGSMBKSA-N |
| Density | 0.956g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.029°C at 760 mmHg (Cal.) |
| Flash point | 141.394°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Methylphenyl)Methylene]Heptan-1-Al |