|
CAS#: 84697-16-5 Product: beta-Chlorophenethyl Chloroformate No suppilers available for the product. |
| Name | beta-Chlorophenethyl Chloroformate |
|---|---|
| Synonyms | (2-Chloro-2-Phenyl-Ethyl) Chloroformate; Chloroformic Acid (2-Chloro-2-Phenylethyl) Ester; Chloroformic Acid (2-Chloro-2-Phenyl-Ethyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8Cl2O2 |
| Molecular Weight | 219.07 |
| CAS Registry Number | 84697-16-5 |
| EINECS | 283-726-2 |
| SMILES | C1=C(C(Cl)COC(Cl)=O)C=CC=C1 |
| InChI | 1S/C9H8Cl2O2/c10-8(6-13-9(11)12)7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | OTRYZZCHZJTDCZ-UHFFFAOYSA-N |
| Density | 1.322g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.198°C at 760 mmHg (Cal.) |
| Flash point | 154.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Chlorophenethyl Chloroformate |