|
CAS#: 84712-65-2 Product: 2-[5-(5-Chloro-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-ylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid No suppilers available for the product. |
| Name | 2-[5-(5-Chloro-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-ylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| Synonyms | α-benzyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18ClN3O3S2 |
| Molecular Weight | 459.97 |
| CAS Registry Number | 84712-65-2 |
| EINECS | 283-756-6 |
| SMILES | S=C2SC(C(=O)N2C(Cc1ccccc1)C(O)=O)=C4N(C)c3ccc(Cl)cc3N4C |
| InChI | 1S/C21H18ClN3O3S2/c1-23-14-9-8-13(22)11-15(14)24(2)18(23)17-19(26)25(21(29)30-17)16(20(27)28)10-12-6-4-3-5-7-12/h3-9,11,16H,10H2,1-2H3,(H,27,28) |
| InChIKey | CWYZKJWRWUSWHT-UHFFFAOYSA-N |
| Density | 1.57g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.589°C at 760 mmHg (Cal.) |
| Flash point | 298.882°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[5-(5-Chloro-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-ylidene)-4-oxo-2-thioxo-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |