|
CAS#: 84712-82-3 Product: 2,2,6,6-Tetramethylpiperidin-4-Yl Isocyanate No suppilers available for the product. |
| Name | 2,2,6,6-Tetramethylpiperidin-4-Yl Isocyanate |
|---|---|
| Synonyms | 4-Isocyanato-2,2,6,6-Tetramethyl-Piperidine; 2,2,6,6-Tetramethylpiperidin-4-Yl Isocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 |
| CAS Registry Number | 84712-82-3 |
| EINECS | 283-773-9 |
| SMILES | O=C=NC1CC(NC(C1)(C)C)(C)C |
| InChI | 1S/C10H18N2O/c1-9(2)5-8(11-7-13)6-10(3,4)12-9/h8,12H,5-6H2,1-4H3 |
| InChIKey | DURXSPOWVBWKMA-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.399°C at 760 mmHg (Cal.) |
| Flash point | 90.723°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,6,6-Tetramethylpiperidin-4-Yl Isocyanate |