|
CAS#: 84731-75-9 Product: 2-(1,7,7-Trimethylbicyclo[2.2.1]hept-2-en-2-yl)pyridine No suppilers available for the product. |
| Name | 2-(1,7,7-Trimethylbicyclo[2.2.1]hept-2-en-2-yl)pyridine |
|---|---|
| Synonyms | PYRIDINE, |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 |
| CAS Registry Number | 84731-75-9 |
| EINECS | 283-835-5 |
| SMILES | CC3(C)C1CCC3(C)C(=C1)c2ccccn2 |
| InChI | 1S/C15H19N/c1-14(2)11-7-8-15(14,3)12(10-11)13-6-4-5-9-16-13/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | NUKWWIUNFJZQDK-UHFFFAOYSA-N |
| Density | 1.03g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.112°C at 760 mmHg (Cal.) |
| Flash point | 127.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,7,7-Trimethylbicyclo[2.2.1]hept-2-en-2-yl)pyridine |