|
CAS#: 84746-04-3 Product: 3-Dimethylamino-6-Methoxyacridine No suppilers available for the product. |
| Name | 3-Dimethylamino-6-Methoxyacridine |
|---|---|
| Synonyms | 6-Methoxy-N,N-Dimethyl-Acridin-3-Amine; 6-Methoxy-N,N-Dimethyl-3-Acridinamine; (6-Methoxyacridin-3-Yl)-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 |
| CAS Registry Number | 84746-04-3 |
| SMILES | C2=CC(=CC3=NC1=CC(=CC=C1C=C23)OC)N(C)C |
| InChI | 1S/C16H16N2O/c1-18(2)13-6-4-11-8-12-5-7-14(19-3)10-16(12)17-15(11)9-13/h4-10H,1-3H3 |
| InChIKey | DTOVJCQISCTEIV-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.039°C at 760 mmHg (Cal.) |
| Flash point | 223.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Dimethylamino-6-Methoxyacridine |