|
CAS#: 847505-83-3 Product: 3-Bromo-7-methoxy-1-naphthonitrile No suppilers available for the product. |
| Name | 3-Bromo-7-methoxy-1-naphthonitrile |
|---|---|
| Synonyms | 1-NAPHTHALENECARBONITRILE,3-BROMO-7-METHOXY-; 3-Bromo-7-methoxy-1-naphthonitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8BrNO |
| Molecular Weight | 262.10 |
| CAS Registry Number | 847505-83-3 |
| SMILES | N#Cc2c1c(ccc(OC)c1)cc(Br)c2 |
| InChI | 1S/C12H8BrNO/c1-15-11-3-2-8-4-10(13)5-9(7-14)12(8)6-11/h2-6H,1H3 |
| InChIKey | GRKYKMLRLISEPI-UHFFFAOYSA-N |
| Density | 1.545g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.458°C at 760 mmHg (Cal.) |
| Flash point | 183.894°C (Cal.) |
| Refractive index | 1.665 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-7-methoxy-1-naphthonitrile |