|
CAS#: 847802-85-1 Product: 5-Fluoro-6-hydroxy-1-naphthoic acid No suppilers available for the product. |
| Name | 5-Fluoro-6-hydroxy-1-naphthoic acid |
|---|---|
| Synonyms | 1-Naphthalenecarboxylic acid, 5-fluoro-6-hydroxy-; 1-NAPHTHALENECARBOXYLICACID, 5-FLUORO-6-HYDROXY-; 5-Fluor-6-hydroxy-1-naphthoesäure |
| Molecular Structure | ![]() |
| Molecular Formula | C11H7FO3 |
| Molecular Weight | 206.17 |
| CAS Registry Number | 847802-85-1 |
| SMILES | c1cc2c(ccc(c2F)O)c(c1)C(=O)O |
| InChI | 1S/C11H7FO3/c12-10-7-2-1-3-8(11(14)15)6(7)4-5-9(10)13/h1-5,13H,(H,14,15) |
| InChIKey | BXYLFSCZRGHQSK-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.4±25.0°C at 760 mmHg (Cal.) |
| Flash point | 212.3±23.2°C (Cal.) |
| Refractive index | 1.688 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Fluoro-6-hydroxy-1-naphthoic acid |