|
CAS#: 84782-21-8 Product: 4-(5-Pyridin-3-Yl-2-Tert-Butyl-3H-Imidazol-4-Yl)Phenol No suppilers available for the product. |
| Name | 4-(5-Pyridin-3-Yl-2-Tert-Butyl-3H-Imidazol-4-Yl)Phenol |
|---|---|
| Synonyms | 4-[2-Tert-Butyl-5-(3-Pyridyl)-3H-Imidazol-4-Yl]Phenol; Cgp 8716; Cgp-8716 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 |
| CAS Registry Number | 84782-21-8 |
| SMILES | C3=C(C1=C(N=C([NH]1)C(C)(C)C)C2=CN=CC=C2)C=CC(=C3)O |
| InChI | 1S/C18H19N3O/c1-18(2,3)17-20-15(12-6-8-14(22)9-7-12)16(21-17)13-5-4-10-19-11-13/h4-11,22H,1-3H3,(H,20,21) |
| InChIKey | MZGWIQCWWSGSRK-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.397°C at 760 mmHg (Cal.) |
| Flash point | 263.689°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(5-Pyridin-3-Yl-2-Tert-Butyl-3H-Imidazol-4-Yl)Phenol |