|
CAS#: 84812-69-1 Product: 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl (2Z)-2-methyl-2-butenoate No suppilers available for the product. |
| Name | 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl (2Z)-2-methyl-2-butenoate |
|---|---|
| Synonyms | (E)-2-methoxy-4-(1-propenyl)phenyl 2-methylisocrotonate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.30 |
| CAS Registry Number | 84812-69-1 |
| EINECS | 284-213-6 |
| SMILES | COc1cc(ccc1OC(=O)C(/C)=C\C)\C=C\C |
| InChI | 1S/C15H18O3/c1-5-7-12-8-9-13(14(10-12)17-4)18-15(16)11(3)6-2/h5-10H,1-4H3/b7-5+,11-6- |
| InChIKey | ZTMOFQLUZSNPJG-WXLRGLDMSA-N |
| Density | 1.048g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.204°C at 760 mmHg (Cal.) |
| Flash point | 161.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-4-[(1E)-1-propen-1-yl]phenyl (2Z)-2-methyl-2-butenoate |