|
CAS#: 84824-86-2 Product: (5alpha,6alpha)-3-Methoxy-17-methyl-4,5-epoxymorphinan-6-yl acetate hydrochloride (1:1) No suppilers available for the product. |
| Name | (5alpha,6alpha)-3-Methoxy-17-methyl-4,5-epoxymorphinan-6-yl acetate hydrochloride (1:1) |
|---|---|
| Synonyms | (5α,6α)-4 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 |
| CAS Registry Number | 84824-86-2 |
| EINECS | 284-238-2 |
| SMILES | Cl.CC(=O)O[C@H]1CC[C@H]3[C@H]2Cc5ccc(OC)c4O[C@@H]1[C@]3(CCN2C)c45 |
| InChI | 1S/C20H25NO4.ClH/c1-11(22)24-16-7-5-13-14-10-12-4-6-15(23-3)18-17(12)20(13,19(16)25-18)8-9-21(14)2;/h4,6,13-14,16,19H,5,7-10H2,1-3H3;1H/t13-,14+,16-,19-,20-;/m0./s1 |
| InChIKey | XTOJZLLCLXRDDW-RIMCYNRYSA-N |
| Boiling point | 490.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 250.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5alpha,6alpha)-3-Methoxy-17-methyl-4,5-epoxymorphinan-6-yl acetate hydrochloride (1:1) |