|
CAS#: 84852-42-6 Product: Potassium bis{2-[(2-ethylhexyl)oxy]ethyl} phosphate No suppilers available for the product. |
| Name | Potassium bis{2-[(2-ethylhexyl)oxy]ethyl} phosphate |
|---|---|
| Synonyms | Potassium bis(2-((2-ethylhexyl)oxy)ethyl) phosphate; potassium bis[2-[(2-ethylhexyl)oxy]ethyl] phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C20H42KO6P |
| Molecular Weight | 448.62 |
| CAS Registry Number | 84852-42-6 |
| EINECS | 284-354-3 |
| SMILES | [K+].[O-]P(=O)(OCCOCC(CCCC)CC)OCCOCC(CC)CCCC |
| InChI | 1S/C20H43O6P.K/c1-5-9-11-19(7-3)17-23-13-15-25-27(21,22)26-16-14-24-18-20(8-4)12-10-6-2;/h19-20H,5-18H2,1-4H3,(H,21,22);/q;+1/p-1 |
| InChIKey | XJWGZRPJAJERTO-UHFFFAOYSA-M |
| Boiling point | 479.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 243.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium bis{2-[(2-ethylhexyl)oxy]ethyl} phosphate |