|
CAS#: 84864-59-5 Product: Diammonium D-glucarate No suppilers available for the product. |
| Name | Diammonium D-glucarate |
|---|---|
| Synonyms | diammonium D-glucarate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16N2O8 |
| Molecular Weight | 244.20 |
| CAS Registry Number | 84864-59-5 |
| EINECS | 284-382-6 |
| SMILES | [NH4+].[NH4+].O[C@@H]([C@H](O)[C@@H](O)C([O-])=O)[C@H](O)C([O-])=O |
| InChI | 1S/C6H10O8.2H3N/c7-1(3(9)5(11)12)2(8)4(10)6(13)14;;/h1-4,7-10H,(H,11,12)(H,13,14);2*1H3/t1-,2-,3-,4+;;/m0../s1 |
| InChIKey | LZWIOJIGSVGZID-SDFKWCIISA-N |
| Boiling point | 791.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 432.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diammonium D-glucarate |