|
CAS#: 84946-17-8 Product: 3-(2-Bromoethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one No suppilers available for the product. |
| Name | 3-(2-Bromoethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H13BrN2O |
| Molecular Weight | 281.15 |
| CAS Registry Number | 84946-17-8 |
| EINECS | 284-620-9 |
| SMILES | O=C2C(CCBr)=C(C)N=C1C=CC(C)=CN12 |
| InChI | 1S/C12H13BrN2O/c1-8-3-4-11-14-9(2)10(5-6-13)12(16)15(11)7-8/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | FPEHIWWVZSYTKT-UHFFFAOYSA-N |
| Density | 1.461g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.345°C at 760 mmHg (Cal.) |
| Flash point | 177.174°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Bromoethyl)-2,7-dimethyl-4H-pyrido[1,2-a]pyrimidin-4-one |