|
CAS#: 84962-54-9 Product: Ethyl N-[1-(4-fluorophenyl)ethyl]-N-formyl-3-oxoalaninate No suppilers available for the product. |
| Name | Ethyl N-[1-(4-fluorophenyl)ethyl]-N-formyl-3-oxoalaninate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H16FNO4 |
| Molecular Weight | 281.28 |
| CAS Registry Number | 84962-54-9 |
| EINECS | 284-752-7 |
| SMILES | Fc1ccc(cc1)C(C)N(C=O)C(C=O)C(=O)OCC |
| InChI | 1S/C14H16FNO4/c1-3-20-14(19)13(8-17)16(9-18)10(2)11-4-6-12(15)7-5-11/h4-10,13H,3H2,1-2H3 |
| InChIKey | BFUFOHMVMTXWGL-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.666°C at 760 mmHg (Cal.) |
| Flash point | 211.84°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl N-[1-(4-fluorophenyl)ethyl]-N-formyl-3-oxoalaninate |