|
CAS#: 84962-76-5 Product: 2-(Chloromethyl)-2-(2,4-Dichlorophenyl)-1,3-Dioxolane No suppilers available for the product. |
| Name | 2-(Chloromethyl)-2-(2,4-Dichlorophenyl)-1,3-Dioxolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 |
| CAS Registry Number | 84962-76-5 |
| EINECS | 284-775-2 |
| SMILES | C1=CC(=CC(=C1C2(OCCO2)CCl)Cl)Cl |
| InChI | 1S/C10H9Cl3O2/c11-6-10(14-3-4-15-10)8-2-1-7(12)5-9(8)13/h1-2,5H,3-4,6H2 |
| InChIKey | CLGGAEHNDWBJKR-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.346°C at 760 mmHg (Cal.) |
| Flash point | 136.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Chloromethyl)-2-(2,4-Dichlorophenyl)-1,3-Dioxolane |