|
CAS#: 84963-39-3 Product: 3-(Phenethyl)Pyridine-2-Carboxamide No suppilers available for the product. |
| Name | 3-(Phenethyl)Pyridine-2-Carboxamide |
|---|---|
| Synonyms | 3-(2-Phenylethyl)-2-Pyridinecarboxamide; 3-(2-Phenylethyl)Picolinamide; 3-(Phenethyl)Pyridine-2-Carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 |
| CAS Registry Number | 84963-39-3 |
| EINECS | 284-842-6 |
| SMILES | C1=CC=C(C(=N1)C(=O)N)CCC2=CC=CC=C2 |
| InChI | 1S/C14H14N2O/c15-14(17)13-12(7-4-10-16-13)9-8-11-5-2-1-3-6-11/h1-7,10H,8-9H2,(H2,15,17) |
| InChIKey | PDHDODYVLUEHER-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.804°C at 760 mmHg (Cal.) |
| Flash point | 192.571°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Phenethyl)Pyridine-2-Carboxamide |