|
CAS#: 85-07-4 Product: 2-Methylnaphthalene-1-Acetamide No suppilers available for the product. |
| Name | 2-Methylnaphthalene-1-Acetamide |
|---|---|
| Synonyms | 2-(2-Methyl-1-Naphthyl)Acetamide; 2-(2-Methylnaphthalen-1-Yl)Ethanamide; 1-Naphthaleneacetamide, 2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| CAS Registry Number | 85-07-4 |
| EINECS | 201-585-7 |
| SMILES | C1=CC2=C(C=C1)C(=C(C)C=C2)CC(=O)N |
| InChI | 1S/C13H13NO/c1-9-6-7-10-4-2-3-5-11(10)12(9)8-13(14)15/h2-7H,8H2,1H3,(H2,14,15) |
| InChIKey | AFOVBPMGZPJPKX-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.887°C at 760 mmHg (Cal.) |
| Flash point | 214.998°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylnaphthalene-1-Acetamide |