|
CAS#: 85-67-6 Product: 8-Amino-5-[(p-Aminophenyl)Azo]Naphthalene-2-Sulphonic Acid No suppilers available for the product. |
| Name | 8-Amino-5-[(p-Aminophenyl)Azo]Naphthalene-2-Sulphonic Acid |
|---|---|
| Synonyms | 8-Amino-5-(4-Aminophenyl)Azo-Naphthalene-2-Sulfonic Acid; 8-Amino-5-(4-Aminophenyl)Azo-2-Naphthalenesulfonic Acid; 8-Amino-5-(4-Aminophenyl)Diazenyl-Naphthalene-2-Sulfonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.37 |
| CAS Registry Number | 85-67-6 |
| EINECS | 201-621-1 |
| SMILES | C1=CC2=C(C=C1[S](=O)(=O)O)C(=CC=C2N=NC3=CC=C(C=C3)N)N |
| InChI | 1S/C16H14N4O3S/c17-10-1-3-11(4-2-10)19-20-16-8-7-15(18)14-9-12(24(21,22)23)5-6-13(14)16/h1-9H,17-18H2,(H,21,22,23) |
| InChIKey | PUFPLSIDSWPRQM-UHFFFAOYSA-N |
| Density | 1.52g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 8-Amino-5-[(p-Aminophenyl)Azo]Naphthalene-2-Sulphonic Acid |