Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 3-Chloro[1,1'-Biphenyl]-2-Ol |
|---|---|
| Synonyms | 2-Chloro-6-Phenyl-Phenol; Biphenylol, Chloro-; Chlorobiphenylol |
| Molecular Structure | ![CAS#: 85-97-2, 3-Chloro[1,1'-Biphenyl]-2-Ol](/moreStructures/85-97-2.gif) |
| Molecular Formula | C12H9ClO |
| Molecular Weight | 204.66 |
| CAS Registry Number | 85-97-2 |
| EINECS | 201-644-7 |
| SMILES | C1=CC=C(C(=C1C2=CC=CC=C2)O)Cl |
| InChI | 1S/C12H9ClO/c13-11-8-4-7-10(12(11)14)9-5-2-1-3-6-9/h1-8,14H |
| InChIKey | XBILVINOJVKEHG-UHFFFAOYSA-N |
| Density | 1.24g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.499°C at 760 mmHg (Cal.) |
| Flash point | 138.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro[1,1'-Biphenyl]-2-Ol |