|
CAS#: 85005-62-5 Product: 1-(2,3-Diisopropylphenyl)-1,3-butanedione No suppilers available for the product. |
| Name | 1-(2,3-Diisopropylphenyl)-1,3-butanedione |
|---|---|
| Synonyms | 1-(diisopropylphenyl)butane-1,3-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.34 |
| CAS Registry Number | 85005-62-5 |
| EINECS | 284-994-3 |
| SMILES | CC(C)c1cccc(c1C(C)C)C(=O)CC(C)=O |
| InChI | 1S/C16H22O2/c1-10(2)13-7-6-8-14(16(13)11(3)4)15(18)9-12(5)17/h6-8,10-11H,9H2,1-5H3 |
| InChIKey | MAIKJEHQRKKPLL-UHFFFAOYSA-N |
| Density | 0.98g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.389°C at 760 mmHg (Cal.) |
| Flash point | 127.67°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,3-Diisopropylphenyl)-1,3-butanedione |