|
CAS#: 85006-30-0 Product: N2-Butyl-N-(2-chloro-6-methylphenyl)glycinamide 2-hydroxy-1,2,3-propanetricarboxylate (2:1) No suppilers available for the product. |
| Name | N2-Butyl-N-(2-chloro-6-methylphenyl)glycinamide 2-hydroxy-1,2,3-propanetricarboxylate (2:1) |
|---|---|
| Synonyms | bis[2-(bu |
| Molecular Structure | ![]() |
| Molecular Formula | C32H46Cl2N4O9 |
| Molecular Weight | 701.64 |
| CAS Registry Number | 85006-30-0 |
| EINECS | 285-059-2 |
| SMILES | Clc1cccc(C)c1NC(=O)CNCCCC.OC(=O)C(O)(CC(O)=O)CC(O)=O.CCCCNCC(=O)Nc1c(C)cccc1Cl |
| InChI | 1S/2C13H19ClN2O.C6H8O7/c2*1-3-4-8-15-9-12(17)16-13-10(2)6-5-7-11(13)14;7-3(8)1-6(13,5(11)12)2-4(9)10/h2*5-7,15H,3-4,8-9H2,1-2H3,(H,16,17);13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | BANLAHZFNMQJRA-UHFFFAOYSA-N |
| Boiling point | 814.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 446.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N2-Butyl-N-(2-chloro-6-methylphenyl)glycinamide 2-hydroxy-1,2,3-propanetricarboxylate (2:1) |