|
CAS#: 85008-87-3 Product: 1,8-Dihydro-1,3-Diphenyldibenzo(b,f)Pyrazolo(3,4-d)Azepine No suppilers available for the product. |
| Name | 1,8-Dihydro-1,3-Diphenyldibenzo(b,f)Pyrazolo(3,4-d)Azepine |
|---|---|
| Synonyms | Dibenzo(B,F)Pyrazolo(3,4-D)Azepine, 1,8-Dihydro-1,3-Diphenyl-; Diphenyl-1,3 Dihydro-1,8 (Dibenzo(B,F)Pyrazolo(3,4-D))Azepine [French] |
| Molecular Structure | ![]() |
| Molecular Formula | C27H19N3 |
| Molecular Weight | 385.47 |
| CAS Registry Number | 85008-87-3 |
| SMILES | C3=C2C1=C(NN(C1=C4C(=NC2=CC=C3)C=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6 |
| InChI | 1S/C27H19N3/c1-3-11-19(12-4-1)26-25-21-15-7-9-17-23(21)28-24-18-10-8-16-22(24)27(25)30(29-26)20-13-5-2-6-14-20/h1-18,29H |
| InChIKey | XZGPFNPQAKHELN-UHFFFAOYSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 596.052°C at 760 mmHg (Cal.) |
| Flash point | 314.281°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,8-Dihydro-1,3-Diphenyldibenzo(b,f)Pyrazolo(3,4-d)Azepine |