|
CAS#: 85019-87-0 Product: 4-Chloro-2-Methylbenzenesulfonamide No suppilers available for the product. |
| Name | 4-Chloro-2-Methylbenzenesulfonamide |
|---|---|
| Synonyms | 4-Chloro-2-Methyl-Benzenesulfonamide; Nciopen2_004108; Nsc77050 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8ClNO2S |
| Molecular Weight | 205.66 |
| CAS Registry Number | 85019-87-0 |
| SMILES | C1=CC(=CC(=C1[S](N)(=O)=O)C)Cl |
| InChI | 1S/C7H8ClNO2S/c1-5-4-6(8)2-3-7(5)12(9,10)11/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | GVLBNAYYKLMCSH-UHFFFAOYSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.309°C at 760 mmHg (Cal.) |
| Flash point | 171.104°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-Methylbenzenesulfonamide |