|
CAS#: 85074-80-2 Product: 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-chlorobenzene) No suppilers available for the product. |
| Name | 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-chlorobenzene) |
|---|---|
| Synonyms | 1,1'-[(1E)-1,2-difluoro-1,2-ethenediyl]bis[4-chlorobenzene] |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Cl2F2 |
| Molecular Weight | 285.12 |
| CAS Registry Number | 85074-80-2 |
| SMILES | C1=CC(=CC=C1/C(=C(/C2=CC=C(C=C2)Cl)\F)/F)Cl |
| InChI | 1S/C14H8Cl2F2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8H/b14-13+ |
| InChIKey | VACJJTILLBXACD-BUHFOSPRSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 195.8±21.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-[(E)-1,2-Difluoro-1,2-ethenediyl]bis(4-chlorobenzene) |