|
CAS#: 85081-54-5 Product: Ammonium O,O-bis(2,3-dimethylphenyl) phosphorodithioate No suppilers available for the product. |
| Name | Ammonium O,O-bis(2,3-dimethylphenyl) phosphorodithioate |
|---|---|
| Synonyms | ammonium O,O-bis(dimethylphenyl) dithiophosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H22NO2PS2 |
| Molecular Weight | 355.46 |
| CAS Registry Number | 85081-54-5 |
| EINECS | 285-344-1 |
| SMILES | [NH4+].S=P([S-])(Oc1cccc(C)c1C)Oc2cccc(C)c2C |
| InChI | 1S/C16H19O2PS2.H3N/c1-11-7-5-9-15(13(11)3)17-19(20,21)18-16-10-6-8-12(2)14(16)4;/h5-10H,1-4H3,(H,20,21);1H3 |
| InChIKey | QKONPSJUWRHZJU-UHFFFAOYSA-N |
| Boiling point | 481°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 244.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium O,O-bis(2,3-dimethylphenyl) phosphorodithioate |