|
CAS#: 85099-17-8 Product: 2-(7,7-Dichloro-6-methylbicyclo[4.1.0]hept-3-yl)-2-propanol No suppilers available for the product. |
| Name | 2-(7,7-Dichloro-6-methylbicyclo[4.1.0]hept-3-yl)-2-propanol |
|---|---|
| Synonyms | 7,7-dichloro-α,α,6-trimethylbicyclo[4.1.0]heptane-3-methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H18Cl2O |
| Molecular Weight | 237.17 |
| CAS Registry Number | 85099-17-8 |
| EINECS | 285-471-2 |
| SMILES | ClC2(Cl)C1CC(CCC12C)C(O)(C)C |
| InChI | 1S/C11H18Cl2O/c1-9(2,14)7-4-5-10(3)8(6-7)11(10,12)13/h7-8,14H,4-6H2,1-3H3 |
| InChIKey | ZCMOCXGFGLUTHV-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.019°C at 760 mmHg (Cal.) |
| Flash point | 123.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(7,7-Dichloro-6-methylbicyclo[4.1.0]hept-3-yl)-2-propanol |