Online Database of Chemicals from Around the World
|
CAS#: 85118-30-5 Product: 3-(4-Fluorophenyl)-6-(Trifluoromethyl)Indan-1-Ol No suppilers available for the product. |
| Name | 3-(4-Fluorophenyl)-6-(Trifluoromethyl)Indan-1-Ol |
|---|---|
| Synonyms | 3-(4-Fluorophenyl)-6-(Trifluoromethyl)Indan-1-Ol; 3-(4-Fluorophenyl)-6-(Trifluoromethyl)-1-Indanol |
| Molecular Structure |  |
| Molecular Formula | C16H12F4O |
| Molecular Weight | 296.26 |
| CAS Registry Number | 85118-30-5 |
| EINECS | 285-684-0 |
| SMILES | C1=C(C(F)(F)F)C=CC2=C1C(O)CC2C3=CC=C(F)C=C3 |
| InChI | 1S/C16H12F4O/c17-11-4-1-9(2-5-11)13-8-15(21)14-7-10(16(18,19)20)3-6-12(13)14/h1-7,13,15,21H,8H2 |
| InChIKey | NVYSLELQVQMWNA-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.111°C at 760 mmHg (Cal.) |
| Flash point | 167.356°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Fluorophenyl)-6-(Trifluoromethyl)Indan-1-Ol |