|
CAS#: 851224-81-2 Product: {3-[4-(Trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl}methanol No suppilers available for the product. |
| Name | {3-[4-(Trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl}methanol |
|---|---|
| Synonyms | 1,2,4-Thiadiazole-5-methanol,3-[4-(trifluoromethyl)phenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7F3N2OS |
| Molecular Weight | 260.24 |
| CAS Registry Number | 851224-81-2 |
| SMILES | FC(F)(F)c1ccc(cc1)c2nc(CO)sn2 |
| InChI | 1S/C10H7F3N2OS/c11-10(12,13)7-3-1-6(2-4-7)9-14-8(5-16)17-15-9/h1-4,16H,5H2 |
| InChIKey | RJSAGKWMYSYKHM-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.767°C at 760 mmHg (Cal.) |
| Flash point | 171.986°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for {3-[4-(Trifluoromethyl)phenyl]-1,2,4-thiadiazol-5-yl}methanol |