|
CAS#: 85131-86-8 Product: 1,6-Dibromo-2,3,5-Trichlorononafluorohexane No suppilers available for the product. |
| Name | 1,6-Dibromo-2,3,5-Trichlorononafluorohexane |
|---|---|
| Synonyms | 1,6-Dibromo-2,3,5-Trichloro-1,1,2,3,4,4,5,6,6-Nonafluoro-Hexane; 1,6-Dibromo-2,3,5-Trichlorononafluorohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C6Br2Cl3F9 |
| Molecular Weight | 509.22 |
| CAS Registry Number | 85131-86-8 |
| SMILES | ClC(C(C(C(C(Br)(F)F)(F)Cl)(F)F)(Cl)F)(C(Br)(F)F)F |
| InChI | 1S/C6Br2Cl3F9/c7-5(17,18)2(10,13)1(9,12)4(15,16)3(11,14)6(8,19)20 |
| InChIKey | RKKGNUHLABLELO-UHFFFAOYSA-N |
| Density | 2.145g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.522°C at 760 mmHg (Cal.) |
| Flash point | 104.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dibromo-2,3,5-Trichlorononafluorohexane |