|
CAS#: 85135-81-5 Product: (17beta)-3-Oxoandrost-4-en-17-yl 2-hydroxy-3-oxododecanoate No suppilers available for the product. |
| Name | (17beta)-3-Oxoandrost-4-en-17-yl 2-hydroxy-3-oxododecanoate |
|---|---|
| Synonyms | 17β-hydroxyandrost-4-en-3-one decanoylglycolate |
| Molecular Structure | ![]() |
| Molecular Formula | C31H48O5 |
| Molecular Weight | 500.71 |
| CAS Registry Number | 85135-81-5 |
| EINECS | 285-702-7 |
| SMILES | CCCCCCCCCC(=O)C(O)C(=O)O[C@H]2CC[C@H]1[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| InChI | 1S/C31H48O5/c1-4-5-6-7-8-9-10-11-26(33)28(34)29(35)36-27-15-14-24-23-13-12-21-20-22(32)16-18-30(21,2)25(23)17-19-31(24,27)3/h20,23-25,27-28,34H,4-19H2,1-3H3/t23-,24-,25-,27-,28?,30-,31-/m0/s1 |
| InChIKey | GFNGHNQLACFSPX-GHJVWEBLSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 614.816°C at 760 mmHg (Cal.) |
| Flash point | 190.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (17beta)-3-Oxoandrost-4-en-17-yl 2-hydroxy-3-oxododecanoate |