|
CAS#: 85153-88-4 Product: Tert-Butyl 1,1,3,3-Tetramethylbutyl Peroxide No suppilers available for the product. |
| Name | Tert-Butyl 1,1,3,3-Tetramethylbutyl Peroxide |
|---|---|
| Synonyms | 2-Tert-Butylperoxy-2,4,4-Trimethyl-Pentane; 2-Tert-Butyldioxy-2,4,4-Trimethylpentane; Tert-Butyl 1,1,3,3-Tetramethylbutyl Peroxide |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 |
| CAS Registry Number | 85153-88-4 |
| EINECS | 285-873-8 |
| SMILES | C(C(C)(C)C)C(C)(C)OOC(C)(C)C |
| InChI | 1S/C12H26O2/c1-10(2,3)9-12(7,8)14-13-11(4,5)6/h9H2,1-8H3 |
| InChIKey | POHYRDMTJGJYHH-UHFFFAOYSA-N |
| Density | 0.845g/cm3 (Cal.) |
|---|---|
| Boiling point | 210.94°C at 760 mmHg (Cal.) |
| Flash point | 42.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tert-Butyl 1,1,3,3-Tetramethylbutyl Peroxide |