|
CAS#: 85169-26-2 Product: 6-Chloro-2-{[4-(dimethylamino)phenyl]imino}-4-methyl-1-benzothiophen-3(2H)-one No suppilers available for the product. |
| Name | 6-Chloro-2-{[4-(dimethylamino)phenyl]imino}-4-methyl-1-benzothiophen-3(2H)-one |
|---|---|
| Synonyms | 6-chloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15ClN2OS |
| Molecular Weight | 330.83 |
| CAS Registry Number | 85169-26-2 |
| EINECS | 285-968-4 |
| SMILES | CN(C)c1ccc(cc1)N=C3Sc2cc(Cl)cc(C)c2C3=O |
| InChI | 1S/C17H15ClN2OS/c1-10-8-11(18)9-14-15(10)16(21)17(22-14)19-12-4-6-13(7-5-12)20(2)3/h4-9H,1-3H3 |
| InChIKey | WMIXBYOQXRAJMV-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.023°C at 760 mmHg (Cal.) |
| Flash point | 274.953°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-2-{[4-(dimethylamino)phenyl]imino}-4-methyl-1-benzothiophen-3(2H)-one |