|
CAS#: 85187-14-0 Product: 1-Phenyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-2-Buten-1-One No suppilers available for the product. |
| Name | 1-Phenyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-2-Buten-1-One |
|---|---|
| Synonyms | 1-Phenyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-2-Buten-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 |
| CAS Registry Number | 85187-14-0 |
| EINECS | 286-101-2 |
| SMILES | C2=C(C(=O)/C=C/CC1C(C(=CC1)C)(C)C)C=CC=C2 |
| InChI | 1S/C18H22O/c1-14-12-13-16(18(14,2)3)10-7-11-17(19)15-8-5-4-6-9-15/h4-9,11-12,16H,10,13H2,1-3H3/b11-7+ |
| InChIKey | RYRMZVXRCMBVTD-YRNVUSSQSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.792°C at 760 mmHg (Cal.) |
| Flash point | 148.081°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-2-Buten-1-One |