|
CAS#: 85188-02-9 Product: 4,4'-[(4-Imino-3-methyl-2,5-cyclohexadien-1-ylidene)methylene]bis(2-methylaniline) sulfate (2:1) No suppilers available for the product. |
| Name | 4,4'-[(4-Imino-3-methyl-2,5-cyclohexadien-1-ylidene)methylene]bis(2-methylaniline) sulfate (2:1) |
|---|---|
| Synonyms | bis(4-[(4 |
| Molecular Structure | ![]() |
| Molecular Formula | C44H48N6O4S |
| Molecular Weight | 756.95 |
| CAS Registry Number | 85188-02-9 |
| EINECS | 286-192-9 |
| SMILES | OS(O)(=O)=O.Nc1ccc(cc1C)C(c2ccc(N)c(C)c2)=C3C=C(C)C(=N)C=C3.Nc1ccc(cc1C)C(c2cc(C)c(N)cc2)=C3C=C(C)C(=N)C=C3 |
| InChI | 1S/2C22H23N3.H2O4S/c2*1-13-10-16(4-7-19(13)23)22(17-5-8-20(24)14(2)11-17)18-6-9-21(25)15(3)12-18;1-5(2,3)4/h2*4-12,23H,24-25H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | RYIDLCVNCSFERI-UHFFFAOYSA-N |
| Boiling point | 1025.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 573.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-[(4-Imino-3-methyl-2,5-cyclohexadien-1-ylidene)methylene]bis(2-methylaniline) sulfate (2:1) |