|
CAS#: 85204-19-9 Product: 2-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)-3-buten-2-ol No suppilers available for the product. |
| Name | 2-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)-3-buten-2-ol |
|---|---|
| Synonyms | α,3,3-trimethyl-α-vinylbicyclo[2.2.1]heptane-2-methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.31 |
| CAS Registry Number | 85204-19-9 |
| EINECS | 286-314-0 |
| SMILES | CC2(C)C(C1CCC2C1)C(C)(O)C=C |
| InChI | 1S/C13H22O/c1-5-13(4,14)11-9-6-7-10(8-9)12(11,2)3/h5,9-11,14H,1,6-8H2,2-4H3 |
| InChIKey | AVXCORVLTFVQGV-UHFFFAOYSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.763°C at 760 mmHg (Cal.) |
| Flash point | 100.875°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,3-Dimethylbicyclo[2.2.1]hept-2-yl)-3-buten-2-ol |