|
CAS#: 85204-34-8 Product: 2-[2-Cyclopentyl-4-(1,1-Dimethylethyl)Phenoxy]Propionic Acid No suppilers available for the product. |
| Name | 2-[2-Cyclopentyl-4-(1,1-Dimethylethyl)Phenoxy]Propionic Acid |
|---|---|
| Synonyms | 2-(4-Tert-Butyl-2-Cyclopentyl-Phenoxy)Propanoic Acid; 2-(4-Tert-Butyl-2-Cyclopentyl-Phenoxy)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 85204-34-8 |
| EINECS | 286-330-8 |
| SMILES | C1=C(C(C)(C)C)C=CC(=C1C2CCCC2)OC(C(=O)O)C |
| InChI | 1S/C18H26O3/c1-12(17(19)20)21-16-10-9-14(18(2,3)4)11-15(16)13-7-5-6-8-13/h9-13H,5-8H2,1-4H3,(H,19,20) |
| InChIKey | IIBQTSAECXHWKN-UHFFFAOYSA-N |
| Density | 1.069g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.806°C at 760 mmHg (Cal.) |
| Flash point | 136.719°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-Cyclopentyl-4-(1,1-Dimethylethyl)Phenoxy]Propionic Acid |