|
CAS#: 85222-97-5 Product: Ammonium 2-Ethylhexyl Hydrogen Phosphate No suppilers available for the product. |
| Name | Ammonium 2-Ethylhexyl Hydrogen Phosphate |
|---|---|
| Synonyms | Ammonium 2-Ethylhexyl Hydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H22NO4P |
| Molecular Weight | 227.24 |
| CAS Registry Number | 85222-97-5 |
| EINECS | 286-349-1 |
| SMILES | C(C(CC)CO[P](O)([O-])=O)CCC.[NH4+] |
| InChI | 1S/C8H19O4P.H3N/c1-3-5-6-8(4-2)7-12-13(9,10)11;/h8H,3-7H2,1-2H3,(H2,9,10,11);1H3 |
| InChIKey | AUZYDJMRJRSCDX-UHFFFAOYSA-N |
| Boiling point | 372.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2-Ethylhexyl Hydrogen Phosphate |